
CAS 1220031-39-9
:Propanamide, 2-amino-2-methyl-N,N-di-2-propen-1-yl-, hydrochloride (1:1)
Description:
Propanamide, 2-amino-2-methyl-N,N-di-2-propen-1-yl-, hydrochloride (1:1), with CAS number 1220031-39-9, is a chemical compound characterized by its amide functional group and the presence of a quaternary ammonium structure due to the two propenyl groups attached to the nitrogen atom. This compound typically appears as a white to off-white solid and is soluble in water, which is a common trait for hydrochloride salts. The presence of the amino group contributes to its basicity, while the amide functionality can influence its reactivity and interactions with other molecules. It may exhibit biological activity, making it of interest in pharmaceutical research. The hydrochloride form enhances its stability and solubility, facilitating its use in various applications, including potential medicinal uses. As with many amides, it may participate in hydrogen bonding, affecting its physical properties and behavior in solution. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C10H18N2O·ClH
InChI:InChI=1S/C10H18N2O.ClH/c1-5-7-12(8-6-2)9(13)10(3,4)11;/h5-6H,1-2,7-8,11H2,3-4H3;1H
InChI key:InChIKey=JSZAIEZEJWKRIF-UHFFFAOYSA-N
SMILES:C(N(CC=C)CC=C)(C(C)(C)N)=O.Cl
Synonyms:- Propanamide, 2-amino-2-methyl-N,N-di-2-propen-1-yl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.