CAS 1220031-50-4

N-[(4-Chloro-2-pyridinyl)carbonyl]-2-methylalanine

Description:

N-[(4-Chloro-2-pyridinyl)carbonyl]-2-methylalanine, identified by its CAS number 1220031-50-4, is an organic compound characterized by its unique structure, which includes a pyridine ring substituted with a chlorine atom and a carbonyl group linked to a 2-methylalanine moiety. This compound features both polar and non-polar functional groups, contributing to its solubility properties and potential interactions in biological systems. The presence of the chlorinated pyridine suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with halogenated heterocycles. Additionally, the amino acid component may influence its role in protein synthesis or as a building block in peptide synthesis. The compound's stability, reactivity, and specific applications would depend on its chemical environment and the presence of other functional groups. Overall, N-[(4-Chloro-2-pyridinyl)carbonyl]-2-methylalanine represents a versatile structure with potential implications in various fields, including drug design and biochemistry.

Formula: C₁₀H₁₁ClN₂O₃

InChI: InChI=1S/C10H11ClN2O3/c1-10(2,9(15)16)13-8(14)7-5-6(11)3-4-12-7/h3-5H,1-2H3,(H,13,14)(H,15,16)

InChI key: InChIKey=FHZGPYQITPSXGM-UHFFFAOYSA-N

SMILES: C(NC(C(O)=O)(C)C)(=O)C1=CC(Cl)=CC=N1

Synonyms:

• N-[(4-Chloro-2-pyridinyl)carbonyl]-2-methylalanine
• Alanine, N-[(4-chloro-2-pyridinyl)carbonyl]-2-methyl-