CAS 1220031-52-6

Propanamide, 2-amino-N,2-dimethyl-N-[(tetrahydro-2H-pyran-4-yl)methyl]-, hydrochloride (1:1)

Description:

Propanamide, 2-amino-N,2-dimethyl-N-[(tetrahydro-2H-pyran-4-yl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is indicative of its potential as a polar molecule with hydrogen bonding capabilities. The presence of the dimethyl and tetrahydro-pyran moieties suggests that it has a complex structure, contributing to its lipophilicity and possibly influencing its solubility in organic solvents. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its bioavailability in pharmaceutical applications. The compound may exhibit biological activity due to the amino group, which can participate in various biochemical interactions. Its specific properties, such as melting point, boiling point, and reactivity, would depend on the overall molecular structure and the presence of functional groups. Given its complexity, it may be of interest in medicinal chemistry, particularly in the development of new therapeutic agents.

Formula: C₁₁H₂₂N₂O₂·ClH

InChI: InChI=1S/C11H22N2O2.ClH/c1-11(2,12)10(14)13(3)8-9-4-6-15-7-5-9;/h9H,4-8,12H2,1-3H3;1H

InChI key: InChIKey=TVPKOQGGLNLNFO-UHFFFAOYSA-N

SMILES: C(N(C(C(C)(C)N)=O)C)C1CCOCC1.Cl

Synonyms:

• Propanamide, 2-amino-N,2-dimethyl-N-[(tetrahydro-2H-pyran-4-yl)methyl]-, hydrochloride (1:1)