
CAS 1220031-56-0
:Pyrrolidine, 3-[[(3-methylphenyl)methoxy]methyl]-, hydrochloride (1:1)
Description:
Pyrrolidine, 3-[[(3-methylphenyl)methoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated heterocycle containing one nitrogen atom. The compound features a 3-substituted pyrrolidine with a methoxy group attached to a 3-methylphenyl moiety, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the aromatic ring may impart specific biological activities, making it of interest in medicinal chemistry. Additionally, the compound's hydrochloride form suggests potential stability and ease of handling, which are important for storage and formulation. Overall, this compound's structural characteristics and salt form contribute to its potential applications in drug development and research.
Formula:C13H19NO·ClH
InChI:InChI=1S/C13H19NO.ClH/c1-11-3-2-4-12(7-11)9-15-10-13-5-6-14-8-13;/h2-4,7,13-14H,5-6,8-10H2,1H3;1H
InChI key:InChIKey=QJNYIGUPFJRAOH-UHFFFAOYSA-N
SMILES:C(OCC1CCNC1)C2=CC(C)=CC=C2.Cl
Synonyms:- Pyrrolidine, 3-[[(3-methylphenyl)methoxy]methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.