CAS 1220031-61-7

Piperidine, 3-[2-[(4-fluorophenyl)methoxy]ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[2-[(4-fluorophenyl)methoxy]ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a 4-fluorophenyl group attached via a methoxyethyl linker contributes to its unique properties, potentially influencing its biological activity and solubility. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The compound may exhibit specific pharmacological effects due to its structural features, which can interact with biological targets. Its molecular interactions, stability, and reactivity are influenced by the functional groups present, particularly the fluorine atom, which can enhance lipophilicity and alter the compound's pharmacokinetic profile. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings.

Formula: C₁₄H₂₀FNO·ClH

InChI: InChI=1S/C14H20FNO.ClH/c15-14-5-3-13(4-6-14)11-17-9-7-12-2-1-8-16-10-12;/h3-6,12,16H,1-2,7-11H2;1H

InChI key: InChIKey=IZCHGMAGCFOQRL-UHFFFAOYSA-N

SMILES: C(OCCC1CCCNC1)C2=CC=C(F)C=C2.Cl

Synonyms:

• Piperidine, 3-[2-[(4-fluorophenyl)methoxy]ethyl]-, hydrochloride (1:1)