CAS 1220031-63-9

Acetic acid, 2-methoxy-, 4-piperidinyl ester, hydrochloride (1:1)

Description:

Acetic acid, 2-methoxy-, 4-piperidinyl ester, hydrochloride (1:1) is a chemical compound characterized by its ester functional group derived from acetic acid and a piperidine moiety. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to its free base. The presence of the methoxy group contributes to its polarity and potential reactivity, while the piperidine ring may influence its biological activity, making it of interest in medicinal chemistry. The hydrochloride form indicates that the compound is a salt, which can affect its stability and handling properties. This compound may be studied for its pharmacological properties, particularly in relation to its potential use in therapeutic applications. As with many chemical substances, safety precautions should be observed when handling it, including the use of appropriate personal protective equipment to mitigate any risks associated with exposure.

Formula: C₈H₁₅NO₃·ClH

InChI: InChI=1S/C8H15NO3.ClH/c1-11-6-8(10)12-7-2-4-9-5-3-7;/h7,9H,2-6H2,1H3;1H

InChI key: InChIKey=CYUCOFSOCPRMHH-UHFFFAOYSA-N

SMILES: O(C(COC)=O)C1CCNCC1.Cl

Synonyms:

• Acetic acid, 2-methoxy-, 4-piperidinyl ester, hydrochloride (1:1)