CAS 1220031-79-7

Piperidine, 4-[2-(2,4-dimethylphenoxy)ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[2-(2,4-dimethylphenoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a substituent that includes a 2,4-dimethylphenoxy group attached to a 2-ethyl chain, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents, making it useful in various applications, including pharmaceuticals and organic synthesis. The presence of the piperidine moiety suggests potential biological activity, as piperidine derivatives are often explored for their roles in medicinal chemistry. The compound's molecular structure may influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, this compound exemplifies the diverse functionalities that can arise from modifications to basic heterocyclic structures.

Formula: C₁₅H₂₃NO·ClH

InChI: InChI=1S/C15H23NO.ClH/c1-12-3-4-15(13(2)11-12)17-10-7-14-5-8-16-9-6-14;/h3-4,11,14,16H,5-10H2,1-2H3;1H

InChI key: InChIKey=PCVKWJHMHOLIPN-UHFFFAOYSA-N

SMILES: O(CCC1CCNCC1)C2=C(C)C=C(C)C=C2.Cl

Synonyms:

• Piperidine, 4-[2-(2,4-dimethylphenoxy)ethyl]-, hydrochloride (1:1)