
CAS 1220031-81-1
:Pyrrolidine, 3-[(2-ethylphenoxy)methyl]-, hydrochloride (1:1)
Description:
Pyrrolidine, 3-[(2-ethylphenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of the 2-ethylphenoxy group indicates that it has an ether functional group, contributing to its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The compound may exhibit biological activity, potentially influencing its use in medicinal chemistry. Its molecular structure suggests that it could interact with biological targets, making it of interest in drug development. Additionally, the presence of the ethylphenoxy moiety may enhance lipophilicity, affecting its pharmacokinetic properties. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity. Overall, this compound represents a unique combination of structural features that may confer specific properties relevant to its applications.
Formula:C13H19NO·ClH
InChI:InChI=1S/C13H19NO.ClH/c1-2-12-5-3-4-6-13(12)15-10-11-7-8-14-9-11;/h3-6,11,14H,2,7-10H2,1H3;1H
InChI key:InChIKey=MHAYJTUNMAAVIQ-UHFFFAOYSA-N
SMILES:O(CC1CCNC1)C2=C(CC)C=CC=C2.Cl
Synonyms:- Pyrrolidine, 3-[(2-ethylphenoxy)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.