
CAS 1220031-88-8
:Benzoic acid, 3-[2-(2-piperidinyl)ethoxy]-, ethyl ester, hydrochloride (1:1)
Description:
Benzoic acid, 3-[2-(2-piperidinyl)ethoxy]-, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety, an ethyl ester group, and a piperidine-derived substituent. This compound typically appears as a white to off-white solid and is soluble in polar solvents, reflecting its ionic hydrochloride form. The presence of the piperidine ring suggests potential biological activity, as piperidine derivatives are often associated with pharmacological properties. The ethoxy group enhances the lipophilicity of the molecule, potentially influencing its absorption and distribution in biological systems. As a hydrochloride salt, it is likely to exhibit improved stability and solubility compared to its free base form. This compound may be of interest in medicinal chemistry and drug development, particularly for its potential applications in therapeutic agents. However, specific biological activities, toxicity, and detailed physicochemical properties would require further investigation through empirical studies.
Formula:C16H23NO3·ClH
InChI:InChI=1S/C16H23NO3.ClH/c1-2-19-16(18)13-6-5-8-15(12-13)20-11-9-14-7-3-4-10-17-14;/h5-6,8,12,14,17H,2-4,7,9-11H2,1H3;1H
InChI key:InChIKey=MBAXIAUWSAFCCX-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CC(OCCC2CCCCN2)=CC=C1.Cl
Synonyms:- Benzoic acid, 3-[2-(2-piperidinyl)ethoxy]-, ethyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.