CAS 1220031-95-7

Benzoic acid, 4-methoxy-, 3-piperidinyl ester, hydrochloride (1:1)

Description:

Benzoic acid, 4-methoxy-, 3-piperidinyl ester, hydrochloride (1:1) is a chemical compound characterized by its ester functional group, which is formed from benzoic acid and a piperidine derivative. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form. The methoxy group at the para position of the benzoic acid moiety contributes to its lipophilicity and can influence its biological activity. The piperidine ring adds to the compound's basicity and can enhance its pharmacological properties. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and pharmaceutical research. Safety data should be consulted for handling and potential toxicity, as with any chemical substance.

Formula: C₁₃H₁₇NO₃·ClH

InChI: InChI=1S/C13H17NO3.ClH/c1-16-11-6-4-10(5-7-11)13(15)17-12-3-2-8-14-9-12;/h4-7,12,14H,2-3,8-9H2,1H3;1H

InChI key: InChIKey=SYMZYFPOVJMPIM-UHFFFAOYSA-N

SMILES: C(OC1CCCNC1)(=O)C2=CC=C(OC)C=C2.Cl

Synonyms:

• Benzoic acid, 4-methoxy-, 3-piperidinyl ester, hydrochloride (1:1)