CAS 1220032-00-7

Propanoic acid, 2-methyl-, 2-(3-piperidinyl)ethyl ester, hydrochloride (1:1)

Description:

Propanoic acid, 2-methyl-, 2-(3-piperidinyl)ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its ester functional group, which is derived from propanoic acid and a piperidine derivative. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, reflecting its polar nature due to the presence of the hydrochloride salt. The piperidine ring contributes to its basicity and potential biological activity, making it of interest in pharmaceutical applications. The presence of the ester group suggests that it may undergo hydrolysis under certain conditions, releasing the corresponding acid and alcohol. Additionally, the compound's hydrochloride form indicates that it is a salt, which can enhance its stability and solubility in aqueous environments. Overall, this compound's unique structure and properties make it relevant in medicinal chemistry and related fields, although specific applications would depend on further research and characterization.

Formula: C₁₁H₂₁NO₂·ClH

InChI: InChI=1S/C11H21NO2.ClH/c1-9(2)11(13)14-7-5-10-4-3-6-12-8-10;/h9-10,12H,3-8H2,1-2H3;1H

InChI key: InChIKey=DGEZYTBQOSXYBP-UHFFFAOYSA-N

SMILES: C(COC(C(C)C)=O)C1CCCNC1.Cl

Synonyms:

• Propanoic acid, 2-methyl-, 2-(3-piperidinyl)ethyl ester, hydrochloride (1:1)