
CAS 1220032-20-1
:Piperidine, 2-[2-(2-methoxy-4-methylphenoxy)ethyl]-, hydrochloride (1:1)
Description:
Piperidine, 2-[2-(2-methoxy-4-methylphenoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a side chain that includes a methoxy group and a 4-methylphenoxy moiety, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the piperidine structure often imparts basicity, allowing it to interact with biological systems effectively. This compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with neurotransmitter systems, which could be relevant for drug development. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings.
Formula:C15H23NO2·ClH
InChI:InChI=1S/C15H23NO2.ClH/c1-12-6-7-14(15(11-12)17-2)18-10-8-13-5-3-4-9-16-13;/h6-7,11,13,16H,3-5,8-10H2,1-2H3;1H
InChI key:InChIKey=WUJRFNXFXMQFKW-UHFFFAOYSA-N
SMILES:O(CCC1CCCCN1)C2=C(OC)C=C(C)C=C2.Cl
Synonyms:- Piperidine, 2-[2-(2-methoxy-4-methylphenoxy)ethyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.