
CAS 1220032-30-3
:Piperidine, 3-[2-(2,4-difluorophenoxy)ethyl]-, hydrochloride (1:1)
Description:
Piperidine, 3-[2-(2,4-difluorophenoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a difluorophenoxy group, indicating the presence of a phenyl ring substituted with two fluorine atoms and an ether linkage to an ethyl chain. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents. This compound may exhibit biological activity, potentially interacting with various receptors or enzymes, making it of interest in medicinal chemistry. Its molecular structure suggests it could be used in the development of pharmaceuticals, particularly in the context of neurological or psychiatric disorders, given the known properties of piperidine derivatives. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its pharmacological profile and applications.
Formula:C13H17F2NO·ClH
InChI:InChI=1S/C13H17F2NO.ClH/c14-11-3-4-13(12(15)8-11)17-7-5-10-2-1-6-16-9-10;/h3-4,8,10,16H,1-2,5-7,9H2;1H
InChI key:InChIKey=MOAPJAIADAJZTC-UHFFFAOYSA-N
SMILES:O(CCC1CCCNC1)C2=C(F)C=C(F)C=C2.Cl
Synonyms:- Piperidine, 3-[2-(2,4-difluorophenoxy)ethyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.