CAS 1220032-46-1

Piperidine, 2-[2-[(2,6-difluorophenyl)methoxy]ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 2-[2-[(2,6-difluorophenyl)methoxy]ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered ring containing five carbon atoms and one nitrogen atom. The presence of a 2,6-difluorophenyl group indicates that two fluorine atoms are substituted on the phenyl ring, enhancing its lipophilicity and potentially influencing its biological activity. The methoxyethyl side chain contributes to the compound's overall structure and may affect its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for pharmaceutical applications. The compound may exhibit various pharmacological properties, potentially acting as a ligand for specific receptors or enzymes. Its unique structural features suggest potential utility in medicinal chemistry, particularly in the development of therapeutic agents. However, detailed studies would be necessary to fully elucidate its biological activity and safety profile.

Formula: C₁₄H₁₉F₂NO·ClH

InChI: InChI=1S/C14H19F2NO.ClH/c15-13-5-3-6-14(16)12(13)10-18-9-7-11-4-1-2-8-17-11;/h3,5-6,11,17H,1-2,4,7-10H2;1H

InChI key: InChIKey=MGHXFQLPASUZPE-UHFFFAOYSA-N

SMILES: C(OCCC1CCCCN1)C2=C(F)C=CC=C2F.Cl

Synonyms:

• Piperidine, 2-[2-[(2,6-difluorophenyl)methoxy]ethyl]-, hydrochloride (1:1)