CAS 1220032-55-2

Piperidine, 4-[2-(2-chloro-4-nitrophenoxy)ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[2-(2-chloro-4-nitrophenoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a substituent that includes a chloro and nitro group on a phenoxyethyl chain, contributing to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the nitro group may impart specific electronic properties, influencing its interaction with biological targets. Additionally, the chloro substituent can affect the compound's lipophilicity and overall pharmacokinetics. Safety and handling precautions are essential, as compounds with nitro and chloro groups can exhibit toxicity and environmental concerns. Overall, this compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of therapeutic agents.

Formula: C₁₃H₁₇ClN₂O₃·ClH

InChI: InChI=1S/C13H17ClN2O3.ClH/c14-12-9-11(16(17)18)1-2-13(12)19-8-5-10-3-6-15-7-4-10;/h1-2,9-10,15H,3-8H2;1H

InChI key: InChIKey=HYWJRJOLEFTMSQ-UHFFFAOYSA-N

SMILES: O(CCC1CCNCC1)C2=C(Cl)C=C(N(=O)=O)C=C2.Cl

Synonyms:

• Piperidine, 4-[2-(2-chloro-4-nitrophenoxy)ethyl]-, hydrochloride (1:1)