CAS 1220032-62-1

Piperidine, 4-(4-bromo-2-ethylphenoxy)-, hydrochloride (1:1)

Description:

Piperidine, 4-(4-bromo-2-ethylphenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a 4-bromo-2-ethylphenoxy substituent, indicating the presence of a bromine atom and an ethyl group attached to a phenolic structure, which contributes to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the bromine atom may impart specific reactivity and biological activity, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. Safety and handling precautions should be observed due to the presence of halogenated compounds, which may exhibit toxicity or environmental concerns. Overall, this compound represents a specific class of piperidine derivatives with potential applications in drug development and research.

Formula: C₁₃H₁₈BrNO·ClH

InChI: InChI=1S/C13H18BrNO.ClH/c1-2-10-9-11(14)3-4-13(10)16-12-5-7-15-8-6-12;/h3-4,9,12,15H,2,5-8H2,1H3;1H

InChI key: InChIKey=XXFLRXVFBNSIQF-UHFFFAOYSA-N

SMILES: O(C1=C(CC)C=C(Br)C=C1)C2CCNCC2.Cl

Synonyms:

• Piperidine, 4-(4-bromo-2-ethylphenoxy)-, hydrochloride (1:1)