CAS 1220032-64-3

Pyrrolidine, 3-(4-bromo-2-ethylphenoxy)-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-(4-bromo-2-ethylphenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated heterocycle containing one nitrogen atom. The compound features a 4-bromo-2-ethylphenoxy substituent, indicating the presence of a bromine atom and an ethyl group attached to a phenolic structure, which contributes to its unique chemical properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the bromine atom may impart specific reactivity and biological activity, making it of interest in medicinal chemistry. The compound's molecular interactions, stability, and potential biological effects would depend on its specific structure and substituents. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogenated groups, due to potential toxicity or reactivity.

Formula: C₁₂H₁₆BrNO·ClH

InChI: InChI=1S/C12H16BrNO.ClH/c1-2-9-7-10(13)3-4-12(9)15-11-5-6-14-8-11;/h3-4,7,11,14H,2,5-6,8H2,1H3;1H

InChI key: InChIKey=MJTWFDBIKJGRHQ-UHFFFAOYSA-N

SMILES: O(C1=C(CC)C=C(Br)C=C1)C2CCNC2.Cl

Synonyms:

• Pyrrolidine, 3-(4-bromo-2-ethylphenoxy)-, hydrochloride (1:1)