CAS 1220032-65-4

Piperidine, 4-[2-bromo-4-(phenylmethyl)phenoxy]-, hydrochloride (1:1)

Description:

Piperidine, 4-[2-bromo-4-(phenylmethyl)phenoxy]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a phenoxy group and a bromo-substituted phenylmethyl moiety, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the bromine atom may impart specific reactivity or biological properties, making it of interest in medicinal chemistry. The compound's structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. Its CAS number, 1220032-65-4, allows for precise identification and retrieval of information regarding its properties, safety data, and regulatory status. Overall, this compound exemplifies the complexity and diversity of organic molecules used in research and development.

Formula: C₁₈H₂₀BrNO·ClH

InChI: InChI=1S/C18H20BrNO.ClH/c19-17-13-15(12-14-4-2-1-3-5-14)6-7-18(17)21-16-8-10-20-11-9-16;/h1-7,13,16,20H,8-12H2;1H

InChI key: InChIKey=OCJCQKAFLVOLRV-UHFFFAOYSA-N

SMILES: C(C1=CC(Br)=C(OC2CCNCC2)C=C1)C3=CC=CC=C3.Cl

Synonyms:

• Piperidine, 4-[2-bromo-4-(phenylmethyl)phenoxy]-, hydrochloride (1:1)