CymitQuimica logo

CAS 1220032-66-5

:

Piperidine, 3-[(2,4-dichloro-1-naphthalenyl)oxy]-, hydrochloride (1:1)

Description:
Piperidine, 3-[(2,4-dichloro-1-naphthalenyl)oxy]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The presence of the 2,4-dichloro-1-naphthalenyl group indicates that this compound has significant aromatic characteristics, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The compound may exhibit properties such as being a potential ligand or inhibitor in biochemical pathways, given the structural motifs present. Its synthesis and handling require standard laboratory safety protocols due to the presence of chlorine substituents, which can impart toxicity. Overall, this compound's unique structure suggests it may have applications in medicinal chemistry, particularly in the development of therapeutic agents.
Formula:C15H15Cl2NO·ClH
InChI:InChI=1S/C15H15Cl2NO.ClH/c16-13-8-14(17)15(12-6-2-1-5-11(12)13)19-10-4-3-7-18-9-10;/h1-2,5-6,8,10,18H,3-4,7,9H2;1H
InChI key:InChIKey=FZRGFUFVYGTZEU-UHFFFAOYSA-N
SMILES:O(C=1C2=C(C(Cl)=CC1Cl)C=CC=C2)C3CCCNC3.Cl
Synonyms:
  • Piperidine, 3-[(2,4-dichloro-1-naphthalenyl)oxy]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.