CAS 1220032-70-1

Piperidine, 3-[(1,6-dibromo-2-naphthalenyl)oxy]-, hydrochloride (1:1)

Description:

Piperidine, 3-[(1,6-dibromo-2-naphthalenyl)oxy]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of the 1,6-dibromo-2-naphthalenyl group indicates that this compound has significant aromatic character, contributing to its potential biological activity. The hydrochloride form suggests that it is a salt, which typically enhances solubility in water and may influence its pharmacokinetic properties. This compound may exhibit properties such as being a potential ligand or inhibitor in various biochemical pathways, making it of interest in medicinal chemistry. Its structure suggests that it could interact with biological targets due to the presence of both the piperidine and naphthalene moieties, which may facilitate interactions with proteins or enzymes. As with many halogenated compounds, the bromine atoms may also impart unique reactivity or stability characteristics. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated organic compounds.

Formula: C₁₅H₁₅Br₂NO·ClH

InChI: InChI=1S/C15H15Br2NO.ClH/c16-11-4-5-13-10(8-11)3-6-14(15(13)17)19-12-2-1-7-18-9-12;/h3-6,8,12,18H,1-2,7,9H2;1H

InChI key: InChIKey=TUWDQRQJCSBOKG-UHFFFAOYSA-N

SMILES: BrC=1C2=C(C=CC1OC3CCCNC3)C=C(Br)C=C2.Cl

Synonyms:

• Piperidine, 3-[(1,6-dibromo-2-naphthalenyl)oxy]-, hydrochloride (1:1)