CAS 1220032-87-0

Piperidine, 3-[[2-chloro-4-(1,1-dimethylpropyl)phenoxy]methyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[[2-chloro-4-(1,1-dimethylpropyl)phenoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The presence of a chloro-substituted phenoxy group contributes to its unique properties, potentially influencing its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, particularly in pharmaceuticals. The compound may exhibit specific pharmacological effects due to its structural features, making it of interest in medicinal chemistry. Its CAS number, 1220032-87-0, allows for precise identification in chemical databases. Safety data sheets and handling guidelines should be consulted for information on toxicity, stability, and proper storage conditions, as with any chemical substance. Overall, this compound's characteristics suggest potential applications in drug development and research, although specific biological activities would require further investigation.

Formula: C₁₇H₂₆ClNO·ClH

InChI: InChI=1S/C17H26ClNO.ClH/c1-4-17(2,3)14-7-8-16(15(18)10-14)20-12-13-6-5-9-19-11-13;/h7-8,10,13,19H,4-6,9,11-12H2,1-3H3;1H

InChI key: InChIKey=VSVOGBSKIOCFAH-UHFFFAOYSA-N

SMILES: C(CC)(C)(C)C1=CC(Cl)=C(OCC2CCCNC2)C=C1.Cl

Synonyms:

• Piperidine, 3-[[2-chloro-4-(1,1-dimethylpropyl)phenoxy]methyl]-, hydrochloride (1:1)