CymitQuimica logo

CAS 1220032-96-1

:

Benzoic acid, 2-(3-pyrrolidinyloxy)-, ethyl ester, hydrochloride (1:1)

Description:
Benzoic acid, 2-(3-pyrrolidinyloxy)-, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its ester functional group and the presence of a pyrrolidine moiety. This compound typically exhibits properties associated with both benzoic acid derivatives and pyrrolidine-based structures, which may influence its solubility, stability, and reactivity. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its potential applications in pharmaceutical formulations. The presence of the pyrrolidinyloxy group suggests potential biological activity, possibly interacting with neurotransmitter systems or exhibiting other pharmacological effects. Its molecular structure may contribute to its lipophilicity and ability to penetrate biological membranes. Overall, this compound's characteristics make it of interest in medicinal chemistry, particularly in the development of therapeutic agents. However, specific data regarding its melting point, boiling point, and other physical properties would require further investigation or reference to specialized databases.
Formula:C13H17NO3.ClH
InChI:InChI=1S/C13H17NO3.ClH/c1-2-16-13(15)11-5-3-4-6-12(11)17-10-7-8-14-9-10;/h3-6,10,14H,2,7-9H2,1H3;1H
InChI key:InChIKey=GHZKMRHHNSTHLE-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(OC2CCNC2)C=CC=C1.Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.