CAS 1220032-97-2

Piperidine, 3-[(4-chloro-2-nitrophenoxy)methyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[(4-chloro-2-nitrophenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a 4-chloro-2-nitrophenoxy group attached to the piperidine ring, indicating the presence of both chlorine and nitro functional groups, which can influence its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The presence of the nitro group suggests potential for biological activity, possibly as an antimicrobial or anti-inflammatory agent. The compound's molecular structure contributes to its properties, such as melting point, solubility, and stability, which are essential for its practical applications. Safety data should be consulted for handling and usage, as the presence of chlorine and nitro groups may pose specific hazards.

Formula: C₁₂H₁₅ClN₂O₃·ClH

InChI: InChI=1S/C12H15ClN2O3.ClH/c13-10-3-4-12(11(6-10)15(16)17)18-8-9-2-1-5-14-7-9;/h3-4,6,9,14H,1-2,5,7-8H2;1H

InChI key: InChIKey=LXAZKDZGGAUYDK-UHFFFAOYSA-N

SMILES: O(CC1CCCNC1)C2=C(N(=O)=O)C=C(Cl)C=C2.Cl

Synonyms:

• Piperidine, 3-[(4-chloro-2-nitrophenoxy)methyl]-, hydrochloride (1:1)