
CAS 1220033-07-7
:Piperidine, 4-[(2,4-dichlorophenyl)methoxy]-, hydrochloride (1:1)
Description:
Piperidine, 4-[(2,4-dichlorophenyl)methoxy]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a 2,4-dichlorophenyl group attached via a methoxy linkage contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The compound may exhibit various pharmacological effects, potentially acting as a neurotransmitter modulator or having other therapeutic implications. Its structure suggests it could interact with biological systems, making it of interest in medicinal chemistry. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Proper characterization through techniques such as NMR, IR spectroscopy, and mass spectrometry is crucial for confirming its identity and purity in research and industrial applications.
Formula:C12H15Cl2NO·ClH
InChI:InChI=1S/C12H15Cl2NO.ClH/c13-10-2-1-9(12(14)7-10)8-16-11-3-5-15-6-4-11;/h1-2,7,11,15H,3-6,8H2;1H
InChI key:InChIKey=UJNFVKXHPQOUMR-UHFFFAOYSA-N
SMILES:C(OC1CCNCC1)C2=C(Cl)C=C(Cl)C=C2.Cl
Synonyms:- Piperidine, 4-[(2,4-dichlorophenyl)methoxy]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.