CymitQuimica logo

CAS 1220033-08-8

:

Piperidine, 3-[[(2-chlorophenyl)methoxy]methyl]-, hydrochloride (1:1)

Description:
Piperidine, 3-[[[2-chlorophenyl)methoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocyclic amine. The presence of a 2-chlorophenyl group and a methoxy methyl substituent contributes to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications. This compound may exhibit biological activity, potentially influencing neurotransmitter systems, making it of interest in medicinal chemistry and pharmacology. Its structure suggests it could interact with various receptors or enzymes, although specific biological activities would require empirical investigation. Safety data and handling precautions are essential, as with any chemical, due to potential toxicity or reactivity. Overall, this compound represents a class of piperidine derivatives that may have therapeutic potential, warranting further research into its pharmacological effects and applications.
Formula:C13H18ClNO·ClH
InChI:InChI=1S/C13H18ClNO.ClH/c14-13-6-2-1-5-12(13)10-16-9-11-4-3-7-15-8-11;/h1-2,5-6,11,15H,3-4,7-10H2;1H
InChI key:InChIKey=KATHQUMWMDUPGD-UHFFFAOYSA-N
SMILES:C(OCC1CCCNC1)C2=C(Cl)C=CC=C2.Cl
Synonyms:
  • Piperidine, 3-[[(2-chlorophenyl)methoxy]methyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.