CAS 1220033-11-3
:Pyrrolidine, 3-[(2,4-dichlorophenyl)methoxy]-, hydrochloride (1:1)
Description:
Pyrrolidine, 3-[(2,4-dichlorophenyl)methoxy]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine core, which is a five-membered saturated heterocyclic amine. The presence of a 2,4-dichlorophenyl group attached via a methoxy linkage contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which enhances its utility in pharmaceutical applications. This compound may exhibit various pharmacological effects, potentially acting as a neurotransmitter modulator or having implications in medicinal chemistry. Its structure suggests that it could interact with biological targets, making it of interest in drug development. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties, mechanisms of action, and potential therapeutic applications.
Formula:C11H13Cl2NO·ClH
InChI:InChI=1S/C11H13Cl2NO.ClH/c12-9-2-1-8(11(13)5-9)7-15-10-3-4-14-6-10;/h1-2,5,10,14H,3-4,6-7H2;1H
InChI key:InChIKey=GGNMWLWPDGQZSC-UHFFFAOYSA-N
SMILES:C(OC1CCNC1)C2=C(Cl)C=C(Cl)C=C2.Cl
Synonyms:- Pyrrolidine, 3-[(2,4-dichlorophenyl)methoxy]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
