CymitQuimica logo

CAS 1220033-19-1

:

Piperidine, 3-[2-(2-propen-1-yloxy)ethoxy]-, hydrochloride (1:1)

Description:
Piperidine, 3-[2-(2-propen-1-yloxy)ethoxy]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a side chain that includes an ether linkage, specifically a propenyloxy group, which contributes to its reactivity and potential applications in organic synthesis or medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in biological and pharmaceutical contexts. The presence of the propenyloxy group may impart specific properties such as increased lipophilicity or the ability to participate in further chemical reactions, making it a candidate for various applications. The compound's molecular structure suggests potential interactions with biological targets, which could be explored in drug development. Safety and handling precautions should be observed, as with all chemical substances, particularly those with biological activity.
Formula:C10H19NO2·ClH
InChI:InChI=1S/C10H19NO2.ClH/c1-2-6-12-7-8-13-10-4-3-5-11-9-10;/h2,10-11H,1,3-9H2;1H
InChI key:InChIKey=AAXBQRYMECYGFX-UHFFFAOYSA-N
SMILES:O(CCOCC=C)C1CCCNC1.Cl
Synonyms:
  • Piperidine, 3-[2-(2-propen-1-yloxy)ethoxy]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.