CymitQuimica logo

CAS 1220033-26-0

:

4-Chloro-6-(3-methyl-1-piperidinyl)-1,3,5-triazin-2-amine

Description:
4-Chloro-6-(3-methyl-1-piperidinyl)-1,3,5-triazin-2-amine is a chemical compound characterized by its triazine core, which consists of a six-membered ring containing three nitrogen atoms and three carbon atoms. The presence of a chloro group at the 4-position and a 3-methyl-1-piperidinyl substituent at the 6-position contributes to its unique chemical properties. This compound is typically classified as an organic heterocyclic compound, and its structure suggests potential applications in pharmaceuticals or agrochemicals due to the presence of the piperidine moiety, which is often associated with biological activity. The triazine framework is known for its stability and ability to participate in various chemical reactions, making it a versatile building block in synthetic chemistry. Additionally, the compound may exhibit specific solubility characteristics and reactivity patterns influenced by its functional groups, which can be important for its application in various fields. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or environmental impact.
Formula:C9H14ClN5
InChI:InChI=1S/C9H14ClN5/c1-6-3-2-4-15(5-6)9-13-7(10)12-8(11)14-9/h6H,2-5H2,1H3,(H2,11,12,13,14)
InChI key:InChIKey=USSLPSVVFDJENT-UHFFFAOYSA-N
SMILES:ClC1=NC(=NC(N)=N1)N2CC(C)CCC2
Synonyms:
  • 4-Chloro-6-(3-methyl-1-piperidinyl)-1,3,5-triazin-2-amine
  • 1,3,5-Triazin-2-amine, 4-chloro-6-(3-methyl-1-piperidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.