CAS 1220033-27-1

1-(5-Bromo-2-pyridinyl)-2,3-dihydro-1H-indole

Description:

1-(5-Bromo-2-pyridinyl)-2,3-dihydro-1H-indole is a chemical compound characterized by its unique structure, which includes a dihydroindole core fused with a pyridine ring that is substituted with a bromine atom. This compound typically exhibits properties associated with both indole and pyridine derivatives, such as potential biological activity and the ability to participate in various chemical reactions. The presence of the bromine atom can enhance its reactivity and influence its pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound may exhibit moderate to high lipophilicity due to its aromatic components, which can affect its solubility and bioavailability. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. As with many heterocyclic compounds, it may also display interesting electronic properties, making it suitable for further studies in organic synthesis and material science. Safety and handling precautions should be observed due to the presence of bromine and the potential for biological activity.

Formula: C₁₃H₁₁BrN₂

InChI: InChI=1S/C13H11BrN2/c14-11-5-6-13(15-9-11)16-8-7-10-3-1-2-4-12(10)16/h1-6,9H,7-8H2

InChI key: InChIKey=YIZRSWBFBKCFJE-UHFFFAOYSA-N

SMILES: BrC1=CC=C(N2C=3C(CC2)=CC=CC3)N=C1

Synonyms:

• 1-(5-Bromo-2-pyridinyl)-2,3-dihydro-1H-indole
• 1H-Indole, 1-(5-bromo-2-pyridinyl)-2,3-dihydro-