
CAS 1220033-34-0
:Piperidine, 4-[(2-propoxyethoxy)methyl]-, hydrochloride (1:1)
Description:
Piperidine, 4-[(2-propoxyethoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a propoxyethoxy side chain, contributing to its solubility and potential biological activity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The presence of the piperidine moiety often indicates potential use in medicinal chemistry, as piperidine derivatives are known for their diverse pharmacological properties. The compound's molecular structure suggests it may interact with biological targets, potentially influencing neurotransmitter systems or other physiological pathways. Safety and handling precautions should be observed, as with all chemical substances, particularly those with biological activity. Further studies would be necessary to fully elucidate its properties, including its reactivity, stability, and specific applications in research or industry.
Formula:C11H23NO2·ClH
InChI:InChI=1S/C11H23NO2.ClH/c1-2-7-13-8-9-14-10-11-3-5-12-6-4-11;/h11-12H,2-10H2,1H3;1H
InChI key:InChIKey=LHOGHHOABJDHBI-UHFFFAOYSA-N
SMILES:C(OCCOCCC)C1CCNCC1.Cl
Synonyms:- Piperidine, 4-[(2-propoxyethoxy)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.