CAS 1220033-39-5

Propanamide, 3-amino-N-methyl-N-[(tetrahydro-2H-pyran-4-yl)methyl]-, hydrochloride (1:1)

Description:

Propanamide, 3-amino-N-methyl-N-[(tetrahydro-2H-pyran-4-yl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is indicative of its potential as a polar molecule with hydrogen bonding capabilities. The presence of the amino group suggests it may exhibit basic properties, while the N-methyl substitution can influence its lipophilicity and solubility in organic solvents. The tetrahydro-2H-pyran moiety contributes to the compound's cyclic structure, potentially affecting its conformation and reactivity. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its bioavailability in pharmaceutical applications. This compound may be of interest in medicinal chemistry due to its structural features, which could interact with biological targets. Its specific properties, such as melting point, boiling point, and spectral characteristics, would require empirical determination or literature reference for precise values. Overall, this compound exemplifies the complexity and diversity of amide derivatives in chemical research and development.

Formula: C₁₀H₂₀N₂O₂·ClH

InChI: InChI=1S/C10H20N2O2.ClH/c1-12(10(13)2-5-11)8-9-3-6-14-7-4-9;/h9H,2-8,11H2,1H3;1H

InChI key: InChIKey=XCWDPLJHQITTDO-UHFFFAOYSA-N

SMILES: C(N(C(CCN)=O)C)C1CCOCC1.Cl

Synonyms:

• Propanamide, 3-amino-N-methyl-N-[(tetrahydro-2H-pyran-4-yl)methyl]-, hydrochloride (1:1)