CAS 1220033-43-1

Ethanone, 1-(3,4-dihydro-2(1H)-isoquinolinyl)-2-(methylamino)-, hydrochloride (1:1)

Description:

Ethanone, 1-(3,4-dihydro-2(1H)-isoquinolinyl)-2-(methylamino)-, hydrochloride (1:1), with CAS number 1220033-43-1, is a chemical compound characterized by its complex structure, which includes an ethanone moiety and a dihydroisoquinoline derivative. This compound typically appears as a hydrochloride salt, indicating it is soluble in water and may exhibit ionic characteristics. The presence of the methylamino group suggests potential basic properties, which can influence its reactivity and interaction with biological systems. The dihydroisoquinoline structure may impart specific pharmacological activities, making it of interest in medicinal chemistry. Its hydrochloride form enhances stability and solubility, facilitating its use in various applications, including research and potential therapeutic contexts. As with many organic compounds, its properties such as melting point, boiling point, and spectral characteristics would be essential for identification and characterization, but these specifics would depend on experimental conditions and methods used for analysis.

Formula: C₁₂H₁₆N₂O·ClH

InChI: InChI=1S/C12H16N2O.ClH/c1-13-8-12(15)14-7-6-10-4-2-3-5-11(10)9-14;/h2-5,13H,6-9H2,1H3;1H

InChI key: InChIKey=ZSIMKILMSPRACP-UHFFFAOYSA-N

SMILES: C(CNC)(=O)N1CC=2C(CC1)=CC=CC2.Cl

Synonyms:

• Ethanone, 1-(3,4-dihydro-2(1H)-isoquinolinyl)-2-(methylamino)-, hydrochloride (1:1)