
CAS 1220033-44-2
:Piperidine, 3-(2-methoxyphenoxy)-, hydrochloride (1:1)
Description:
Piperidine, 3-(2-methoxyphenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The compound features a 2-methoxyphenoxy group, indicating the presence of a methoxy-substituted phenyl moiety linked via an ether bond to the piperidine structure. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the hydrochloride indicates that the compound can exist in a protonated form, which may influence its biological activity and stability. This compound may exhibit properties such as potential pharmacological activity, making it of interest in medicinal chemistry. However, specific biological activities, toxicity, and detailed physicochemical properties would require further investigation through experimental studies and literature review.
Formula:C12H17NO2·ClH
InChI:InChI=1S/C12H17NO2.ClH/c1-14-11-6-2-3-7-12(11)15-10-5-4-8-13-9-10;/h2-3,6-7,10,13H,4-5,8-9H2,1H3;1H
InChI key:InChIKey=XXYQWLMWDLHQOF-UHFFFAOYSA-N
SMILES:O(C1=C(OC)C=CC=C1)C2CCCNC2.Cl
Synonyms:- Piperidine, 3-(2-methoxyphenoxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.