CAS 1220033-45-3

1-Propanone, 2-amino-1-(4-hydroxy-1-piperidinyl)-2-methyl-, hydrochloride (1:1)

Description:

1-Propanone, 2-amino-1-(4-hydroxy-1-piperidinyl)-2-methyl-, hydrochloride (1:1), commonly referred to as a hydrochloride salt, is a chemical compound characterized by its structural features that include a propanone backbone, an amino group, and a piperidine ring with a hydroxyl substituent. This compound is typically a white to off-white crystalline solid, soluble in water due to the presence of the hydrochloride moiety, which enhances its solubility and stability. It may exhibit basic properties due to the amino group, allowing it to participate in various chemical reactions, including those typical of amines. The presence of the piperidine ring suggests potential biological activity, making it of interest in pharmaceutical research. Its specific applications and effects would depend on its interaction with biological systems, which could include roles in neurotransmission or other physiological processes. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.

Formula: C₉H₁₈N₂O₂·ClH

InChI: InChI=1S/C9H18N2O2.ClH/c1-9(2,10)8(13)11-5-3-7(12)4-6-11;/h7,12H,3-6,10H2,1-2H3;1H

InChI key: InChIKey=VBWFNRUBADAVMA-UHFFFAOYSA-N

SMILES: C(C(C)(C)N)(=O)N1CCC(O)CC1.Cl

Synonyms:

• 1-Propanone, 2-amino-1-(4-hydroxy-1-piperidinyl)-2-methyl-, hydrochloride (1:1)

2-Amino-1-(4-hydroxypiperidin-1-yl)-2-methylpropan-1-one hydrochloride

CAS: 1220033-45-3

Versatile small molecule scaffold

Formula: C₉H₁₉ClN₂O₂

Purity: Min. 95%

Molecular weight: 222.71 g/mol

Ref: 3D-VYB03345