CAS 1220033-46-4

Propanamide, 3-amino-N-(2-hydroxyethyl)-N-methyl-, hydrochloride (1:1)

Description:

Propanamide, 3-amino-N-(2-hydroxyethyl)-N-methyl-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is indicative of its potential as a polar molecule with hydrogen bonding capabilities. The presence of the amino group suggests that it can participate in various biochemical interactions, making it relevant in pharmaceutical applications. The hydroxyethyl substituent contributes to its solubility in water, enhancing its bioavailability. As a hydrochloride salt, it is typically more stable and easier to handle than its free base form, often resulting in improved solubility in aqueous solutions. This compound may exhibit properties such as moderate to high melting points and specific reactivity patterns typical of amides and amino compounds. Its structure suggests potential applications in medicinal chemistry, particularly in drug design, where modifications to the amide and amino groups can influence pharmacological activity. Overall, the characteristics of this compound make it a subject of interest in both synthetic and medicinal chemistry contexts.

Formula: C₆H₁₄N₂O₂·ClH

InChI: InChI=1S/C6H14N2O2.ClH/c1-8(4-5-9)6(10)2-3-7;/h9H,2-5,7H2,1H3;1H

InChI key: InChIKey=UOKHKGOOEXPWDD-UHFFFAOYSA-N

SMILES: C(N(CCO)C)(CCN)=O.Cl

Synonyms:

• Propanamide, 3-amino-N-(2-hydroxyethyl)-N-methyl-, hydrochloride (1:1)