
CAS 1220033-48-6
:2-Piperazinone, 4-(3-amino-1-oxopropyl)-, hydrochloride (1:1)
Description:
2-Piperazinone, 4-(3-amino-1-oxopropyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic structure containing two nitrogen atoms. This compound features an amino group and a carbonyl group, contributing to its potential as a bioactive molecule. The hydrochloride form indicates that it is a salt, enhancing its solubility in water, which is often desirable for pharmaceutical applications. The presence of the amino and carbonyl functionalities suggests that it may participate in various chemical reactions, including nucleophilic attacks and hydrogen bonding, making it a candidate for further research in medicinal chemistry. Its molecular structure allows for interactions with biological targets, potentially influencing its pharmacological properties. As with many piperazine derivatives, it may exhibit a range of biological activities, including antimicrobial or antitumor effects, although specific biological data would be necessary to confirm these properties. Safety and handling precautions should be observed due to its chemical nature and potential biological activity.
Formula:C7H13N3O2·ClH
InChI:InChI=1S/C7H13N3O2.ClH/c8-2-1-7(12)10-4-3-9-6(11)5-10;/h1-5,8H2,(H,9,11);1H
InChI key:InChIKey=KMNJBJIEJCQCIT-UHFFFAOYSA-N
SMILES:C(CCN)(=O)N1CC(=O)NCC1.Cl
Synonyms:- 2-Piperazinone, 4-(3-amino-1-oxopropyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.