CAS 1220033-59-9

Methanone, (2-methyl-1-piperidinyl)-3-piperidinyl-, hydrochloride (1:1)

Description:

Methanone, (2-methyl-1-piperidinyl)-3-piperidinyl-, hydrochloride (1:1), with the CAS number 1220033-59-9, is a chemical compound characterized by its piperidine structure, which includes two piperidinyl groups attached to a methanone moiety. This compound is typically encountered as a hydrochloride salt, indicating that it is a protonated form that enhances its solubility in water and other polar solvents. The presence of the piperidine rings suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their ability to interact with biological targets. The compound's molecular structure may impart specific pharmacological properties, including potential effects on the central nervous system. As with many piperidine derivatives, it may exhibit various biological activities, but detailed studies would be necessary to elucidate its specific mechanisms and therapeutic potential. Safety and handling precautions should be observed, as with all chemical substances, particularly those with biological activity.

Formula: C₁₂H₂₂N₂O·ClH

InChI: InChI=1S/C12H22N2O.ClH/c1-10-5-2-3-8-14(10)12(15)11-6-4-7-13-9-11;/h10-11,13H,2-9H2,1H3;1H

InChI key: InChIKey=CQMHEKYRJOVXSO-UHFFFAOYSA-N

SMILES: C(=O)(N1C(C)CCCC1)C2CCCNC2.Cl

Synonyms:

• Methanone, (2-methyl-1-piperidinyl)-3-piperidinyl-, hydrochloride (1:1)