CAS 1220033-60-2
:4-(Methylsulfonyl)-N1,N1-dipropyl-1,3-benzenediamine
Description:
4-(Methylsulfonyl)-N1,N1-dipropyl-1,3-benzenediamine, with the CAS number 1220033-60-2, is a chemical compound characterized by its structure, which includes a benzene ring substituted with two propyl groups and a methylsulfonyl group. This compound is typically classified as an aromatic amine due to the presence of amino groups attached to the benzene ring. The methylsulfonyl group contributes to its solubility and reactivity, potentially influencing its interactions in various chemical environments. The presence of the propyl groups may enhance its lipophilicity, affecting its biological activity and transport properties. This compound may be of interest in pharmaceutical applications or as a chemical intermediate in organic synthesis. Its specific properties, such as melting point, boiling point, and reactivity, would depend on the molecular interactions and the environment in which it is studied. Safety data and handling precautions should be considered due to the potential toxicity associated with aromatic amines.
Formula:C13H22N2O2S
InChI:InChI=1S/C13H22N2O2S/c1-4-8-15(9-5-2)11-6-7-13(12(14)10-11)18(3,16)17/h6-7,10H,4-5,8-9,14H2,1-3H3
InChI key:InChIKey=NBSNYHNUKSSEDB-UHFFFAOYSA-N
SMILES:N(CCC)(CCC)C1=CC(N)=C(S(C)(=O)=O)C=C1
Synonyms:- 4-(Methylsulfonyl)-N1,N1-dipropyl-1,3-benzenediamine
- 1,3-Benzenediamine, 4-(methylsulfonyl)-N1,N1-dipropyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.