CAS 1220033-63-5

Piperidine, 4-[[2-(1-methylpropyl)phenoxy]methyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[[2-(1-methylpropyl)phenoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a phenoxy group substituted with a branched alkyl chain, specifically 1-methylpropyl, enhancing its lipophilicity and potentially influencing its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. The presence of the piperidine moiety often suggests potential uses in medicinal chemistry, particularly in the development of psychoactive or analgesic agents. The compound's structure may allow for interactions with various biological targets, making it of interest in drug discovery. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, this compound exemplifies the complexity and diversity of organic molecules used in various chemical and pharmaceutical applications.

Formula: C₁₆H₂₅NO·ClH

InChI: InChI=1S/C16H25NO.ClH/c1-3-13(2)15-6-4-5-7-16(15)18-12-14-8-10-17-11-9-14;/h4-7,13-14,17H,3,8-12H2,1-2H3;1H

InChI key: InChIKey=JXEPOJJXEVVWCJ-UHFFFAOYSA-N

SMILES: O(CC1CCNCC1)C2=C(C(CC)C)C=CC=C2.Cl

Synonyms:

• Piperidine, 4-[[2-(1-methylpropyl)phenoxy]methyl]-, hydrochloride (1:1)