
CAS 1220033-68-0
:Methanone, (2,3-dihydro-1H-indol-1-yl)-3-piperidinyl-, hydrochloride (1:1)
Description:
Methanone, (2,3-dihydro-1H-indol-1-yl)-3-piperidinyl-, hydrochloride (1:1), with the CAS number 1220033-68-0, is a chemical compound characterized by its complex structure that includes an indole moiety and a piperidine ring. This substance typically appears as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications, particularly in pharmaceutical research. The presence of the indole structure suggests potential biological activity, as indole derivatives are often associated with various pharmacological effects. The piperidine component may contribute to its ability to interact with biological targets, potentially influencing neurotransmitter systems. As a hydrochloride salt, it is likely to be stable under standard laboratory conditions, but specific handling and storage guidelines should be followed to maintain its integrity. Overall, this compound may be of interest in medicinal chemistry, particularly in the development of new therapeutic agents.
Formula:C14H18N2O·ClH
InChI:InChI=1S/C14H18N2O.ClH/c17-14(12-5-3-8-15-10-12)16-9-7-11-4-1-2-6-13(11)16;/h1-2,4,6,12,15H,3,5,7-10H2;1H
InChI key:InChIKey=HVFKYGAIAVBHGP-UHFFFAOYSA-N
SMILES:C(=O)(N1C=2C(CC1)=CC=CC2)C3CCCNC3.Cl
Synonyms:- Methanone, (2,3-dihydro-1H-indol-1-yl)-3-piperidinyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.