CAS 1220033-71-5

3-Piperidinecarboxamide, N-ethyl-N-(phenylmethyl)-, hydrochloride (1:1)

Description:

3-Piperidinecarboxamide, N-ethyl-N-(phenylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features an amide functional group, indicating the presence of a carbonyl group (C=O) bonded to a nitrogen atom. The N-ethyl and N-(phenylmethyl) substituents suggest that the nitrogen atom is bonded to both an ethyl group and a benzyl group, contributing to its overall molecular complexity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water than its free base form, which can enhance its utility in pharmaceutical applications. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific interactions and effects would depend on its molecular structure and the presence of functional groups, which can influence its behavior in biological systems. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings.

Formula: C₁₅H₂₂N₂O·ClH

InChI: InChI=1S/C15H22N2O.ClH/c1-2-17(12-13-7-4-3-5-8-13)15(18)14-9-6-10-16-11-14;/h3-5,7-8,14,16H,2,6,9-12H2,1H3;1H

InChI key: InChIKey=PYCFWISWXKSVQP-UHFFFAOYSA-N

SMILES: N(C(=O)C1CCCNC1)(CC2=CC=CC=C2)CC.Cl

Synonyms:

• 3-Piperidinecarboxamide, N-ethyl-N-(phenylmethyl)-, hydrochloride (1:1)