CAS 1220033-78-2

1-[3-Amino-4-(methylsulfonyl)phenyl]-3-pyrrolidinol

Description:

1-[3-Amino-4-(methylsulfonyl)phenyl]-3-pyrrolidinol, identified by its CAS number 1220033-78-2, is a chemical compound characterized by its complex structure, which includes an amino group, a methylsulfonyl group, and a pyrrolidinol moiety. This compound typically exhibits properties such as solubility in polar solvents due to the presence of functional groups that can engage in hydrogen bonding. The methylsulfonyl group enhances its potential for biological activity, possibly influencing its pharmacokinetic properties. The presence of the pyrrolidinol structure may contribute to its stability and reactivity, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific interactions with biological targets, which could be relevant for therapeutic applications. Its synthesis and characterization would involve standard organic chemistry techniques, and its behavior in biological systems would require further investigation through pharmacological studies. Overall, this compound represents a class of molecules that may have significant implications in drug development and therapeutic research.

Formula: C₁₁H₁₆N₂O₃S

InChI: InChI=1S/C11H16N2O3S/c1-17(15,16)11-3-2-8(6-10(11)12)13-5-4-9(14)7-13/h2-3,6,9,14H,4-5,7,12H2,1H3

InChI key: InChIKey=YZSHVCKRSZJSDB-UHFFFAOYSA-N

SMILES: NC=1C=C(C=CC1S(C)(=O)=O)N2CC(O)CC2

Synonyms:

• 3-Pyrrolidinol, 1-[3-amino-4-(methylsulfonyl)phenyl]-
• 1-[3-Amino-4-(methylsulfonyl)phenyl]-3-pyrrolidinol