CAS 1220033-84-0
:N1-Ethyl-4-(methylsulfonyl)-N1-(phenylmethyl)-1,3-benzenediamine
Description:
N1-Ethyl-4-(methylsulfonyl)-N1-(phenylmethyl)-1,3-benzenediamine, identified by its CAS number 1220033-84-0, is a chemical compound characterized by its complex structure, which includes an ethyl group, a methylsulfonyl group, and a phenylmethyl moiety attached to a 1,3-benzenediamine framework. This compound typically exhibits properties associated with aromatic amines, such as potential solubility in organic solvents and moderate stability under standard conditions. The presence of the methylsulfonyl group may impart unique reactivity, influencing its interactions in biological systems or chemical reactions. Additionally, the compound's structure suggests potential applications in pharmaceuticals or agrochemicals, where modifications to amine functionalities can enhance biological activity or selectivity. However, specific physical properties like melting point, boiling point, and solubility would require empirical measurement or detailed literature references for precise characterization. As with many organic compounds, safety data should be consulted to understand any hazards associated with handling or exposure.
Formula:C16H20N2O2S
InChI:InChI=1S/C16H20N2O2S/c1-3-18(12-13-7-5-4-6-8-13)14-9-10-16(15(17)11-14)21(2,19)20/h4-11H,3,12,17H2,1-2H3
InChI key:InChIKey=GSHUIJTXTBFPCT-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=C1)(CC)C2=CC(N)=C(S(C)(=O)=O)C=C2
Synonyms:- 1,3-Benzenediamine, N1-ethyl-4-(methylsulfonyl)-N1-(phenylmethyl)-
- N1-Ethyl-4-(methylsulfonyl)-N1-(phenylmethyl)-1,3-benzenediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.