CAS 1220033-89-5

2-(Ethylsulfonyl)-5-(3-methyl-1-piperidinyl)benzenamine

Description:

2-(Ethylsulfonyl)-5-(3-methyl-1-piperidinyl)benzenamine, identified by its CAS number 1220033-89-5, is a chemical compound characterized by its unique molecular structure, which includes a benzene ring substituted with an ethylsulfonyl group and a piperidinyl moiety. This compound typically exhibits properties associated with both aromatic amines and sulfonyl compounds, such as moderate solubility in polar solvents and potential reactivity due to the presence of the amine functional group. The piperidine ring contributes to its basicity and may influence its pharmacological properties, making it of interest in medicinal chemistry. Additionally, the ethylsulfonyl group can enhance the compound's stability and solubility, potentially affecting its bioavailability. Overall, this compound may be explored for various applications, including drug development, due to its structural features that could interact with biological targets. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise values.

Formula: C₁₄H₂₂N₂O₂S

InChI: InChI=1S/C14H22N2O2S/c1-3-19(17,18)14-7-6-12(9-13(14)15)16-8-4-5-11(2)10-16/h6-7,9,11H,3-5,8,10,15H2,1-2H3

InChI key: InChIKey=NWGBOIZSMGHTMH-UHFFFAOYSA-N

SMILES: NC=1C=C(C=CC1S(CC)(=O)=O)N2CC(C)CCC2

Synonyms:

• 2-(Ethylsulfonyl)-5-(3-methyl-1-piperidinyl)benzenamine
• Benzenamine, 2-(ethylsulfonyl)-5-(3-methyl-1-piperidinyl)-