
CAS 1220033-91-9
:Piperidine, 3-(4-propoxyphenoxy)-, hydrochloride (1:1)
Description:
Piperidine, 3-(4-propoxyphenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a propoxyphenoxy substituent at the 3-position of the piperidine ring, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the propoxy and phenoxy groups may influence its lipophilicity and interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's structure suggests potential for use in research related to neuropharmacology or as a building block in the synthesis of more complex molecules. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C14H21NO2·ClH
InChI:InChI=1S/C14H21NO2.ClH/c1-2-10-16-12-5-7-13(8-6-12)17-14-4-3-9-15-11-14;/h5-8,14-15H,2-4,9-11H2,1H3;1H
InChI key:InChIKey=YNAUWHVDAXBWMR-UHFFFAOYSA-N
SMILES:O(C1=CC=C(OCCC)C=C1)C2CCCNC2.Cl
Synonyms:- Piperidine, 3-(4-propoxyphenoxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.