CymitQuimica logo

CAS 1220033-96-4

:

Piperidine, 4-[2-[2-chloro-4-(1,1-dimethylethyl)phenoxy]ethyl]-, hydrochloride (1:1)

Description:
Piperidine, 4-[2-[2-chloro-4-(1,1-dimethylethyl)phenoxy]ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a chloro-substituted phenoxy group, which contributes to its potential biological activity. The presence of the 1,1-dimethylethyl group enhances its lipophilicity, potentially influencing its pharmacokinetic properties. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various applications, including pharmaceuticals. The compound may exhibit properties such as being a potential ligand for biological targets, and its structure suggests it could interact with neurotransmitter systems. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, this compound's unique structural features make it of interest in medicinal chemistry and drug development.
Formula:C17H26ClNO·ClH
InChI:InChI=1S/C17H26ClNO.ClH/c1-17(2,3)14-4-5-16(15(18)12-14)20-11-8-13-6-9-19-10-7-13;/h4-5,12-13,19H,6-11H2,1-3H3;1H
InChI key:InChIKey=RDPZNGXXTBGHQY-UHFFFAOYSA-N
SMILES:O(CCC1CCNCC1)C2=C(Cl)C=C(C(C)(C)C)C=C2.Cl
Synonyms:
  • Piperidine, 4-[2-[2-chloro-4-(1,1-dimethylethyl)phenoxy]ethyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.