CymitQuimica logo

CAS 1220034-04-7

:

Piperidine, 4-[[4-(1,1,3,3-tetramethylbutyl)phenoxy]methyl]-, hydrochloride (1:1)

Description:
Piperidine, 4-[[4-(1,1,3,3-tetramethylbutyl)phenoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of a phenoxy group, specifically a para-substituted phenyl ring with a bulky 1,1,3,3-tetramethylbutyl substituent, contributes to its unique properties, including increased lipophilicity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, particularly in pharmaceutical formulations. The compound may exhibit properties such as basicity due to the nitrogen atom in the piperidine ring, and it may interact with biological targets, making it of interest in medicinal chemistry. Safety data and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, this compound's structural features suggest potential applications in drug development and research.
Formula:C20H33NO·ClH
InChI:InChI=1S/C20H33NO.ClH/c1-19(2,3)15-20(4,5)17-6-8-18(9-7-17)22-14-16-10-12-21-13-11-16;/h6-9,16,21H,10-15H2,1-5H3;1H
InChI key:InChIKey=GLZZEMBABGROMT-UHFFFAOYSA-N
SMILES:C(CC(C)(C)C)(C)(C)C1=CC=C(OCC2CCNCC2)C=C1.Cl
Synonyms:
  • Piperidine, 4-[[4-(1,1,3,3-tetramethylbutyl)phenoxy]methyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.