
CAS 1220034-10-5
:2-(Di-2-propen-1-ylamino)benzenemethanamine
Description:
2-(Di-2-propen-1-ylamino)benzenemethanamine, identified by its CAS number 1220034-10-5, is an organic compound characterized by its unique structure, which includes a benzene ring substituted with a methanamine group and two propenylamine side chains. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the propenyl groups suggests potential reactivity, particularly in polymerization or cross-linking reactions, making it of interest in materials science and organic synthesis. Additionally, the compound may display biological activity due to its amine functionality, which can interact with biological systems. Its specific applications and behavior would depend on the context of use, including factors like concentration, environment, and the presence of other chemical species. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines.
Formula:C13H18N2
InChI:InChI=1S/C13H18N2/c1-3-9-15(10-4-2)13-8-6-5-7-12(13)11-14/h3-8H,1-2,9-11,14H2
InChI key:InChIKey=KJKXOWKNEPOJLN-UHFFFAOYSA-N
SMILES:N(CC=C)(CC=C)C1=C(CN)C=CC=C1
Synonyms:- 2-(Di-2-propen-1-ylamino)benzenemethanamine
- Benzenemethanamine, 2-(di-2-propen-1-ylamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.