
CAS 1220034-33-2
:3-Piperidinemethanamine, N-cyclohexyl-N-ethyl-, hydrochloride (1:2)
Description:
3-Piperidinemethanamine, N-cyclohexyl-N-ethyl-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which contributes to its basicity and potential for forming salts, such as the hydrochloride form. This compound features a cyclohexyl and an ethyl group attached to the nitrogen atom of the piperidine, which can influence its solubility and interaction with biological systems. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The presence of the piperidine moiety suggests potential activity in medicinal chemistry, particularly in the development of compounds targeting neurological or psychiatric conditions. Its specific properties, such as melting point, boiling point, and reactivity, would depend on the precise molecular interactions and the environment in which it is used. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and minimize risks.
Formula:C14H28N2·2ClH
InChI:InChI=1S/C14H28N2.2ClH/c1-2-16(14-8-4-3-5-9-14)12-13-7-6-10-15-11-13;;/h13-15H,2-12H2,1H3;2*1H
InChI key:InChIKey=BFOJLQDVXFDALD-UHFFFAOYSA-N
SMILES:N(CC1CCCNC1)(CC)C2CCCCC2.Cl
Synonyms:- 3-Piperidinemethanamine, N-cyclohexyl-N-ethyl-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.