CymitQuimica logo

CAS 1220034-36-5

:

6-Chloro-N-(1-methylethyl)-2-pyridinamine

Description:
6-Chloro-N-(1-methylethyl)-2-pyridinamine, identified by its CAS number 1220034-36-5, is a chemical compound that features a pyridine ring substituted with a chlorine atom and an isopropylamine group. This compound is characterized by its aromatic nature due to the presence of the pyridine ring, which contributes to its potential reactivity and interaction with biological systems. The chlorine substituent at the 6-position of the pyridine enhances its electrophilic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. The isopropyl group attached to the nitrogen atom can influence the compound's solubility and lipophilicity, affecting its pharmacokinetic properties if considered for pharmaceutical applications. Additionally, the presence of both nitrogen and chlorine atoms suggests potential for hydrogen bonding and other intermolecular interactions, which can be significant in biological contexts. Overall, this compound's unique structural features may lend it utility in medicinal chemistry and related fields, although specific applications would depend on further research and development.
Formula:C8H11ClN2
InChI:InChI=1S/C8H11ClN2/c1-6(2)10-8-5-3-4-7(9)11-8/h3-6H,1-2H3,(H,10,11)
InChI key:InChIKey=MXLUWILNJVZECS-UHFFFAOYSA-N
SMILES:N(C(C)C)C=1N=C(Cl)C=CC1
Synonyms:
  • 6-Chloro-N-(1-methylethyl)-2-pyridinamine
  • 2-Pyridinamine, 6-chloro-N-(1-methylethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.